C13H18F2O3 — CID 82822285
1-(2,6-difluoro-3-methylphenyl)-2,2-diethoxyethanol (PubChem CID 82822285) has the molecular formula C13H18F2O3 and a molecular weight of 260.28 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-methylphenyl)-2,2-diethoxyethanol.
| Compound Name | 1-(2,6-difluoro-3-methylphenyl)-2,2-diethoxyethanol |
|---|---|
| PubChem CID | 82822285 |
| Molecular Formula | C13H18F2O3 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(2,6-difluoro-3-methylphenyl)-2,2-diethoxyethanol |
| SMILES | CCOC(OCC)C(O)c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C13H18F2O3/c1-4-17-13(18-5-2)12(16)10-9(14)7-6-8(3)11(10)15/h6-7,12-13,16H,4-5H2,1-3H3 |
| InChIKey | BNTYLEYTCULVQF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|