C14H21F2NO — CID 171264115
(1R,2S)-1-amino-1-(2,6-difluoro-3-methylphenyl)-5-methylhexan-2-ol (PubChem CID 171264115) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2,6-difluoro-3-methylphenyl)-5-methylhexan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(2,6-difluoro-3-methylphenyl)-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 171264115 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (1R,2S)-1-amino-1-(2,6-difluoro-3-methylphenyl)-5-methylhexan-2-ol |
| SMILES | Cc1ccc(F)c([C@@H](N)[C@@H](O)CCC(C)C)c1F |
| InChI | InChI=1S/C14H21F2NO/c1-8(2)4-7-11(18)14(17)12-10(15)6-5-9(3)13(12)16/h5-6,8,11,14,18H,4,7,17H2,1-3H3/t11-,14-/m0/s1 |
| InChIKey | AZBLESAPXGULNE-FZMZJTMJSA-N |
| XLogP | 3.07 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |