C9H11BrFNO2 — CID 171859699
1-(2-amino-6-fluorophenyl)-3-bromopropane-1,2-diol (PubChem CID 171859699) has the molecular formula C9H11BrFNO2 and a molecular weight of 264.09 g/mol. Its IUPAC name is 1-(2-amino-6-fluorophenyl)-3-bromopropane-1,2-diol.
| Compound Name | 1-(2-amino-6-fluorophenyl)-3-bromopropane-1,2-diol |
|---|---|
| PubChem CID | 171859699 |
| Molecular Formula | C9H11BrFNO2 |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 1-(2-amino-6-fluorophenyl)-3-bromopropane-1,2-diol |
| SMILES | Nc1cccc(F)c1C(O)C(O)CBr |
| InChI | InChI=1S/C9H11BrFNO2/c10-4-7(13)9(14)8-5(11)2-1-3-6(8)12/h1-3,7,9,13-14H,4,12H2 |
| InChIKey | YXLPZFCTNXIUBI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|