C10H13F2NO2 — CID 171880830
4-amino-1-(2,6-difluorophenyl)butane-1,2-diol (PubChem CID 171880830) has the molecular formula C10H13F2NO2 and a molecular weight of 217.21 g/mol. Its IUPAC name is 4-amino-1-(2,6-difluorophenyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(2,6-difluorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171880830 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 4-amino-1-(2,6-difluorophenyl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H13F2NO2/c11-6-2-1-3-7(12)9(6)10(15)8(14)4-5-13/h1-3,8,10,14-15H,4-5,13H2 |
| InChIKey | JDEQOYKWPWMGJO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |