C10H7F5O4 — CID 72796767
methyl 2,3-dihydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate (PubChem CID 72796767) has the molecular formula C10H7F5O4 and a molecular weight of 286.15 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate.
| Compound Name | methyl 2,3-dihydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate |
|---|---|
| PubChem CID | 72796767 |
| Molecular Formula | C10H7F5O4 |
| Molecular Weight | 286.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | methyl 2,3-dihydroxy-3-(2,3,4,5,6-pentafluorophenyl)propanoate |
| SMILES | COC(=O)C(O)C(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H7F5O4/c1-19-10(18)9(17)8(16)2-3(11)5(13)7(15)6(14)4(2)12/h8-9,16-17H,1H3 |
| InChIKey | XDWFDHPKCAPLIU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.15 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|