C10H12F2O3 — CID 97030750
(1S)-1-(3,4-difluorophenyl)-2,2-dimethoxyethanol (PubChem CID 97030750) has the molecular formula C10H12F2O3 and a molecular weight of 218.20 g/mol. Its IUPAC name is (1S)-1-(3,4-difluorophenyl)-2,2-dimethoxyethanol.
| Compound Name | (1S)-1-(3,4-difluorophenyl)-2,2-dimethoxyethanol |
|---|---|
| PubChem CID | 97030750 |
| Molecular Formula | C10H12F2O3 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (1S)-1-(3,4-difluorophenyl)-2,2-dimethoxyethanol |
| SMILES | COC(OC)[C@@H](O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H12F2O3/c1-14-10(15-2)9(13)6-3-4-7(11)8(12)5-6/h3-5,9-10,13H,1-2H3/t9-/m0/s1 |
| InChIKey | GAUYJXCDJWWILB-VIFPVBQESA-N |
| XLogP | 1.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|