C10H14O4 — CID 15515162
4-(1-hydroxy-2,2-dimethoxyethyl)phenol (PubChem CID 15515162) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-(1-hydroxy-2,2-dimethoxyethyl)phenol.
| Compound Name | 4-(1-hydroxy-2,2-dimethoxyethyl)phenol |
|---|---|
| PubChem CID | 15515162 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-(1-hydroxy-2,2-dimethoxyethyl)phenol |
| SMILES | COC(OC)C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H14O4/c1-13-10(14-2)9(12)7-3-5-8(11)6-4-7/h3-6,9-12H,1-2H3 |
| InChIKey | DJTLEUIWCKATKJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|