C29H26O7 — CID 174778705
1,5-dihydroxy-1,2,4,5-tetrakis(4-hydroxyphenyl)pentan-3-one (PubChem CID 174778705) has the molecular formula C29H26O7 and a molecular weight of 486.52 g/mol. Its IUPAC name is 1,5-dihydroxy-1,2,4,5-tetrakis(4-hydroxyphenyl)pentan-3-one.
| Compound Name | 1,5-dihydroxy-1,2,4,5-tetrakis(4-hydroxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 174778705 |
| Molecular Formula | C29H26O7 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 1,5-dihydroxy-1,2,4,5-tetrakis(4-hydroxyphenyl)pentan-3-one |
| SMILES | O=C(C(c1ccc(O)cc1)C(O)c1ccc(O)cc1)C(c1ccc(O)cc1)C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C29H26O7/c30-21-9-1-17(2-10-21)25(27(34)19-5-13-23(32)14-6-19)29(36)26(18-3-11-22(31)12-4-18)28(35)20-7-15-24(33)16-8-20/h1-16,25-28,30-35H |
| InChIKey | LAVFIUXXALKUJU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |