C9H9ClF2O — CID 116863660
2-chloro-1-(3,4-difluorophenyl)propan-1-ol (PubChem CID 116863660) has the molecular formula C9H9ClF2O and a molecular weight of 206.62 g/mol. Its IUPAC name is 2-chloro-1-(3,4-difluorophenyl)propan-1-ol.
| Compound Name | 2-chloro-1-(3,4-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 116863660 |
| Molecular Formula | C9H9ClF2O |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 2-chloro-1-(3,4-difluorophenyl)propan-1-ol |
| SMILES | CC(Cl)C(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H9ClF2O/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,13H,1H3 |
| InChIKey | OPYAZAPJOCWQCE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|