C13H14N4O4 — CID 170827406
2-[3-(3-azido-1,2-dihydroxypropyl)indol-1-yl]acetic acid (PubChem CID 170827406) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[3-(3-azido-1,2-dihydroxypropyl)indol-1-yl]acetic acid.
| Compound Name | 2-[3-(3-azido-1,2-dihydroxypropyl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 170827406 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[3-(3-azido-1,2-dihydroxypropyl)indol-1-yl]acetic acid |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1cn(CC(=O)O)c2ccccc12 |
| InChI | InChI=1S/C13H14N4O4/c14-16-15-5-11(18)13(21)9-6-17(7-12(19)20)10-4-2-1-3-8(9)10/h1-4,6,11,13,18,21H,5,7H2,(H,19,20) |
| InChIKey | UWFSVTAHGHWISF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|