C11H13N3O4 — CID 170826324
2-[4-(3-azido-1,2-dihydroxypropyl)phenyl]acetic acid (PubChem CID 170826324) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-[4-(3-azido-1,2-dihydroxypropyl)phenyl]acetic acid.
| Compound Name | 2-[4-(3-azido-1,2-dihydroxypropyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 170826324 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-[4-(3-azido-1,2-dihydroxypropyl)phenyl]acetic acid |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C11H13N3O4/c12-14-13-6-9(15)11(18)8-3-1-7(2-4-8)5-10(16)17/h1-4,9,11,15,18H,5-6H2,(H,16,17) |
| InChIKey | BEMCHQZEJOTNDX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|