C10H10N4O3 — CID 170826141
3-azido-1-(2-isocyanatophenyl)propane-1,2-diol (PubChem CID 170826141) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 3-azido-1-(2-isocyanatophenyl)propane-1,2-diol.
| Compound Name | 3-azido-1-(2-isocyanatophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170826141 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 3-azido-1-(2-isocyanatophenyl)propane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1ccccc1N=C=O |
| InChI | InChI=1S/C10H10N4O3/c11-14-13-5-9(16)10(17)7-3-1-2-4-8(7)12-6-15/h1-4,9-10,16-17H,5H2 |
| InChIKey | MQOSSGNFKKFIQR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|