C10H13F3N2O — CID 66518100
[2-[(1R)-1,2-diaminoethyl]-5-(trifluoromethyl)phenyl]methanol (PubChem CID 66518100) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is [2-[(1R)-1,2-diaminoethyl]-5-(trifluoromethyl)phenyl]methanol.
| Compound Name | [2-[(1R)-1,2-diaminoethyl]-5-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 66518100 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | [2-[(1R)-1,2-diaminoethyl]-5-(trifluoromethyl)phenyl]methanol |
| SMILES | NC[C@H](N)c1ccc(C(F)(F)F)cc1CO |
| InChI | InChI=1S/C10H13F3N2O/c11-10(12,13)7-1-2-8(9(15)4-14)6(3-7)5-16/h1-3,9,16H,4-5,14-15H2/t9-/m0/s1 |
| InChIKey | HTSJFLOKWIBZGB-VIFPVBQESA-N |
| XLogP | 1.16 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |