About 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile
3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile (PubChem CID 19591652) has the molecular formula C17H10Cl2N2
and a molecular weight of 313.19 g/mol. Its IUPAC name is 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile |
| PubChem CID | 19591652 |
| Molecular Formula | C17H10Cl2N2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(/C=C/c3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C17H10Cl2N2/c18-15-5-2-11(8-16(15)19)1-4-13-10-21-17-6-3-12(9-20)7-14(13)17/h1-8,10,21H/b4-1+ |
| InChIKey | UBLLCGZOYDYGGT-DAFODLJHSA-N |
| XLogP | 5.52 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile?
The IUPAC name of 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile (CID 19591652) is 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile.
What is the SMILES notation for 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile?
The canonical SMILES for 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile is N#Cc1ccc2[nH]cc(/C=C/c3ccc(Cl)c(Cl)c3)c2c1.
What is the InChIKey of 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile?
The InChIKey is UBLLCGZOYDYGGT-DAFODLJHSA-N. The full InChI is InChI=1S/C17H10Cl2N2/c18-15-5-2-11(8-16(15)19)1-4-13-10-21-17-6-3-12(9-20)7-14(13)17/h1-8,10,21H/b4-1+.
What are the key properties of 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile?
3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile has a molecular weight of 313.19 g/mol, XLogP of 5.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1H-indole-5-carbonitrile is sourced from PubChem (CID 19591652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).