C21H22N4 — CID 175233892
3-(6-amino-4-imino-6-phenylhexan-2-yl)-1H-indole-5-carbonitrile (PubChem CID 175233892) has the molecular formula C21H22N4 and a molecular weight of 330.44 g/mol. Its IUPAC name is 3-(6-amino-4-imino-6-phenylhexan-2-yl)-1H-indole-5-carbonitrile.
| Compound Name | 3-(6-amino-4-imino-6-phenylhexan-2-yl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 175233892 |
| Molecular Formula | C21H22N4 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 3-(6-amino-4-imino-6-phenylhexan-2-yl)-1H-indole-5-carbonitrile |
| SMILES | [H]/N=C(/CC(C)c1c[nH]c2ccc(C#N)cc12)CC(N)c1ccccc1 |
| InChI | InChI=1S/C21H22N4/c1-14(9-17(23)11-20(24)16-5-3-2-4-6-16)19-13-25-21-8-7-15(12-22)10-18(19)21/h2-8,10,13-14,20,23,25H,9,11,24H2,1H3/b23-17- |
| InChIKey | GOYUHXRGLVFMTE-QJOMJCCJSA-N |
| XLogP | 4.64 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|