C25H20N4O3S — CID 172726165
[2-[(5-cyano-1H-indol-3-yl)-(1-methylindol-3-yl)methyl]phenyl] sulfamate (PubChem CID 172726165) has the molecular formula C25H20N4O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is [2-[(5-cyano-1H-indol-3-yl)-(1-methylindol-3-yl)methyl]phenyl] sulfamate.
| Compound Name | [2-[(5-cyano-1H-indol-3-yl)-(1-methylindol-3-yl)methyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 172726165 |
| Molecular Formula | C25H20N4O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [2-[(5-cyano-1H-indol-3-yl)-(1-methylindol-3-yl)methyl]phenyl] sulfamate |
| SMILES | Cn1cc(C(c2ccccc2OS(N)(=O)=O)c2c[nH]c3ccc(C#N)cc23)c2ccccc21 |
| InChI | InChI=1S/C25H20N4O3S/c1-29-15-21(17-6-2-4-8-23(17)29)25(18-7-3-5-9-24(18)32-33(27,30)31)20-14-28-22-11-10-16(13-26)12-19(20)22/h2-12,14-15,25,28H,1H3,(H2,27,30,31) |
| InChIKey | HEGIAJIAVDPSPX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 113.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |