C23H19N3O3S — CID 156903035
[2-[bis(1H-indol-3-yl)methyl]phenyl] sulfamate (PubChem CID 156903035) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is [2-[bis(1H-indol-3-yl)methyl]phenyl] sulfamate.
| Compound Name | [2-[bis(1H-indol-3-yl)methyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 156903035 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [2-[bis(1H-indol-3-yl)methyl]phenyl] sulfamate |
| SMILES | NS(=O)(=O)Oc1ccccc1C(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H19N3O3S/c24-30(27,28)29-22-12-6-3-9-17(22)23(18-13-25-20-10-4-1-7-15(18)20)19-14-26-21-11-5-2-8-16(19)21/h1-14,23,25-26H,(H2,24,27,28) |
| InChIKey | SMFZIQORYDMFTC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |