C24H20ClN3O3S — CID 156903033
[2-[(6-chloro-1-methylindol-3-yl)-(1H-indol-3-yl)methyl]phenyl] sulfamate (PubChem CID 156903033) has the molecular formula C24H20ClN3O3S and a molecular weight of 465.96 g/mol. Its IUPAC name is [2-[(6-chloro-1-methylindol-3-yl)-(1H-indol-3-yl)methyl]phenyl] sulfamate.
| Compound Name | [2-[(6-chloro-1-methylindol-3-yl)-(1H-indol-3-yl)methyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 156903033 |
| Molecular Formula | C24H20ClN3O3S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | [2-[(6-chloro-1-methylindol-3-yl)-(1H-indol-3-yl)methyl]phenyl] sulfamate |
| SMILES | Cn1cc(C(c2ccccc2OS(N)(=O)=O)c2c[nH]c3ccccc23)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H20ClN3O3S/c1-28-14-20(17-11-10-15(25)12-22(17)28)24(19-13-27-21-8-4-2-6-16(19)21)18-7-3-5-9-23(18)31-32(26,29)30/h2-14,24,27H,1H3,(H2,26,29,30) |
| InChIKey | UJANBSZCSPBERG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |