C11H9NO5 — CID 91074600
2-(5-hydroxy-1H-indol-3-yl)propanedioic acid (PubChem CID 91074600) has the molecular formula C11H9NO5 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-(5-hydroxy-1H-indol-3-yl)propanedioic acid.
| Compound Name | 2-(5-hydroxy-1H-indol-3-yl)propanedioic acid |
|---|---|
| PubChem CID | 91074600 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-(5-hydroxy-1H-indol-3-yl)propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)c1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C11H9NO5/c13-5-1-2-8-6(3-5)7(4-12-8)9(10(14)15)11(16)17/h1-4,9,12-13H,(H,14,15)(H,16,17) |
| InChIKey | YPGVZHROFSOADV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|