C11H11F3N2O — CID 84737251
3-(3-amino-1,1,1-trifluoropropan-2-yl)-1H-indol-5-ol (PubChem CID 84737251) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 3-(3-amino-1,1,1-trifluoropropan-2-yl)-1H-indol-5-ol.
| Compound Name | 3-(3-amino-1,1,1-trifluoropropan-2-yl)-1H-indol-5-ol |
|---|---|
| PubChem CID | 84737251 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-(3-amino-1,1,1-trifluoropropan-2-yl)-1H-indol-5-ol |
| SMILES | NCC(c1c[nH]c2ccc(O)cc12)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O/c12-11(13,14)9(4-15)8-5-16-10-2-1-6(17)3-7(8)10/h1-3,5,9,16-17H,4,15H2 |
| InChIKey | OJMNCGLFOVMLPI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |