C12H13F3N2 — CID 84737103
3,3,3-trifluoro-2-(4-methyl-1H-indol-3-yl)propan-1-amine (PubChem CID 84737103) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(4-methyl-1H-indol-3-yl)propan-1-amine.
| Compound Name | 3,3,3-trifluoro-2-(4-methyl-1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 84737103 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3,3,3-trifluoro-2-(4-methyl-1H-indol-3-yl)propan-1-amine |
| SMILES | Cc1cccc2[nH]cc(C(CN)C(F)(F)F)c12 |
| InChI | InChI=1S/C12H13F3N2/c1-7-3-2-4-10-11(7)8(6-17-10)9(5-16)12(13,14)15/h2-4,6,9,17H,5,16H2,1H3 |
| InChIKey | QMXIIHOBQOOQPH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |