C11H12N2O2 — CID 82396670
2-amino-2-(4-methyl-1H-indol-3-yl)acetic acid (PubChem CID 82396670) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-amino-2-(4-methyl-1H-indol-3-yl)acetic acid.
| Compound Name | 2-amino-2-(4-methyl-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 82396670 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-amino-2-(4-methyl-1H-indol-3-yl)acetic acid |
| SMILES | Cc1cccc2[nH]cc(C(N)C(=O)O)c12 |
| InChI | InChI=1S/C11H12N2O2/c1-6-3-2-4-8-9(6)7(5-13-8)10(12)11(14)15/h2-5,10,13H,12H2,1H3,(H,14,15) |
| InChIKey | AXXSMFQAPZAFQL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |