C17H13NO2 — CID 135028802
1-(4-methyl-1H-indol-3-yl)-2-phenylethane-1,2-dione (PubChem CID 135028802) has the molecular formula C17H13NO2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-(4-methyl-1H-indol-3-yl)-2-phenylethane-1,2-dione.
| Compound Name | 1-(4-methyl-1H-indol-3-yl)-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 135028802 |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-(4-methyl-1H-indol-3-yl)-2-phenylethane-1,2-dione |
| SMILES | Cc1cccc2[nH]cc(C(=O)C(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C17H13NO2/c1-11-6-5-9-14-15(11)13(10-18-14)17(20)16(19)12-7-3-2-4-8-12/h2-10,18H,1H3 |
| InChIKey | VAAWSVKXOHTVMN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|