C14H17NO4 — CID 171867517
ethyl 2,3-dihydroxy-3-(4-methyl-1H-indol-3-yl)propanoate (PubChem CID 171867517) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(4-methyl-1H-indol-3-yl)propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-(4-methyl-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 171867517 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-(4-methyl-1H-indol-3-yl)propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1c[nH]c2cccc(C)c12 |
| InChI | InChI=1S/C14H17NO4/c1-3-19-14(18)13(17)12(16)9-7-15-10-6-4-5-8(2)11(9)10/h4-7,12-13,15-17H,3H2,1-2H3 |
| InChIKey | SBMOTYPDKNVSDM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |