C12H14N2O4 — CID 171866265
ethyl 2,3-dihydroxy-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoate (PubChem CID 171866265) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoate |
|---|---|
| PubChem CID | 171866265 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C12H14N2O4/c1-2-18-12(17)10(16)9(15)8-6-14-11-7(8)4-3-5-13-11/h3-6,9-10,15-16H,2H2,1H3,(H,13,14) |
| InChIKey | REAVXAACHOTOLZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |