C10H11N3O2 — CID 141399754
ethyl N-(1H-pyrrolo[2,3-b]pyridin-3-yl)carbamate (PubChem CID 141399754) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is ethyl N-(1H-pyrrolo[2,3-b]pyridin-3-yl)carbamate.
| Compound Name | ethyl N-(1H-pyrrolo[2,3-b]pyridin-3-yl)carbamate |
|---|---|
| PubChem CID | 141399754 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | ethyl N-(1H-pyrrolo[2,3-b]pyridin-3-yl)carbamate |
| SMILES | CCOC(=O)Nc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C10H11N3O2/c1-2-15-10(14)13-8-6-12-9-7(8)4-3-5-11-9/h3-6H,2H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | NPMXWYJLXNLEMV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |