C15H10N4O — CID 151992527
bis(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 151992527) has the molecular formula C15H10N4O and a molecular weight of 262.27 g/mol. Its IUPAC name is bis(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | bis(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 151992527 |
| Molecular Formula | C15H10N4O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | bis(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | O=C(c1c[nH]c2ncccc12)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C15H10N4O/c20-13(11-7-18-14-9(11)3-1-5-16-14)12-8-19-15-10(12)4-2-6-17-15/h1-8H,(H,16,18)(H,17,19) |
| InChIKey | UEZBZQLBTJHVRD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |