C14H10N2O — CID 10998603
phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 10998603) has the molecular formula C14H10N2O and a molecular weight of 222.25 g/mol. Its IUPAC name is phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 10998603 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | phenyl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | O=C(c1ccccc1)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C14H10N2O/c17-13(10-5-2-1-3-6-10)12-9-16-14-11(12)7-4-8-15-14/h1-9H,(H,15,16) |
| InChIKey | SDTVSOYPNNRGOJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |