C18H18N2O — CID 43339406
(4-tert-butylphenyl)-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 43339406) has the molecular formula C18H18N2O and a molecular weight of 278.35 g/mol. Its IUPAC name is (4-tert-butylphenyl)-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | (4-tert-butylphenyl)-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 43339406 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (4-tert-butylphenyl)-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)c2c[nH]c3ncccc23)cc1 |
| InChI | InChI=1S/C18H18N2O/c1-18(2,3)13-8-6-12(7-9-13)16(21)15-11-20-17-14(15)5-4-10-19-17/h4-11H,1-3H3,(H,19,20) |
| InChIKey | JHWTYVNFWTXEDZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |