C13H9N3O — CID 59506817
pyridin-2-yl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 59506817) has the molecular formula C13H9N3O and a molecular weight of 223.24 g/mol. Its IUPAC name is pyridin-2-yl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | pyridin-2-yl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 59506817 |
| Molecular Formula | C13H9N3O |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | pyridin-2-yl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | O=C(c1ccccn1)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C13H9N3O/c17-12(11-5-1-2-6-14-11)10-8-16-13-9(10)4-3-7-15-13/h1-8H,(H,15,16) |
| InChIKey | GVEBBOSRLRCYOI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |