C9H7ClN2O — CID 12778217
2-chloro-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (PubChem CID 12778217) has the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. Its IUPAC name is 2-chloro-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone.
| Compound Name | 2-chloro-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 12778217 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 2-chloro-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
| SMILES | O=C(CCl)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C9H7ClN2O/c10-4-8(13)7-5-12-9-6(7)2-1-3-11-9/h1-3,5H,4H2,(H,11,12) |
| InChIKey | RGALXXOVJMEHOD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|