C12H10N2O — CID 58217085
1-(1H-pyrrolo[2,3-b]pyridin-3-yl)pent-2-yn-1-one (PubChem CID 58217085) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(1H-pyrrolo[2,3-b]pyridin-3-yl)pent-2-yn-1-one.
| Compound Name | 1-(1H-pyrrolo[2,3-b]pyridin-3-yl)pent-2-yn-1-one |
|---|---|
| PubChem CID | 58217085 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-(1H-pyrrolo[2,3-b]pyridin-3-yl)pent-2-yn-1-one |
| SMILES | CCC#CC(=O)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C12H10N2O/c1-2-3-6-11(15)10-8-14-12-9(10)5-4-7-13-12/h4-5,7-8H,2H2,1H3,(H,13,14) |
| InChIKey | DDDHNSTYGBWHOP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|