C14H7F3N2O — CID 63187542
1H-pyrrolo[2,3-b]pyridin-3-yl-(3,4,5-trifluorophenyl)methanone (PubChem CID 63187542) has the molecular formula C14H7F3N2O and a molecular weight of 276.22 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-b]pyridin-3-yl-(3,4,5-trifluorophenyl)methanone.
| Compound Name | 1H-pyrrolo[2,3-b]pyridin-3-yl-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 63187542 |
| Molecular Formula | C14H7F3N2O |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1H-pyrrolo[2,3-b]pyridin-3-yl-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C14H7F3N2O/c15-10-4-7(5-11(16)12(10)17)13(20)9-6-19-14-8(9)2-1-3-18-14/h1-6H,(H,18,19) |
| InChIKey | ILOMBNQPOUCEBZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|