C21H16F2N4O — CID 143384675
[3-[(3,4-difluoroanilino)methylamino]phenyl]-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 143384675) has the molecular formula C21H16F2N4O and a molecular weight of 378.38 g/mol. Its IUPAC name is [3-[(3,4-difluoroanilino)methylamino]phenyl]-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | [3-[(3,4-difluoroanilino)methylamino]phenyl]-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 143384675 |
| Molecular Formula | C21H16F2N4O |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [3-[(3,4-difluoroanilino)methylamino]phenyl]-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | O=C(c1cccc(NCNc2ccc(F)c(F)c2)c1)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C21H16F2N4O/c22-18-7-6-15(10-19(18)23)27-12-26-14-4-1-3-13(9-14)20(28)17-11-25-21-16(17)5-2-8-24-21/h1-11,26-27H,12H2,(H,24,25) |
| InChIKey | GMLIQEGNAARFRJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|