C17H24N4O — CID 146641870
4-butyl-N-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidine-1-carboxamide (PubChem CID 146641870) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-butyl-N-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidine-1-carboxamide.
| Compound Name | 4-butyl-N-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 146641870 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 4-butyl-N-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidine-1-carboxamide |
| SMILES | CCCCC1CCN(C(=O)Nc2c[nH]c3ncccc23)CC1 |
| InChI | InChI=1S/C17H24N4O/c1-2-3-5-13-7-10-21(11-8-13)17(22)20-15-12-19-16-14(15)6-4-9-18-16/h4,6,9,12-13H,2-3,5,7-8,10-11H2,1H3,(H,18,19)(H,20,22) |
| InChIKey | LENIQRYRYJKOAC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |