C11H15N3 — CID 131140420
(1R)-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)butan-1-amine (PubChem CID 131140420) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is (1R)-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)butan-1-amine.
| Compound Name | (1R)-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 131140420 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (1R)-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)butan-1-amine |
| SMILES | CCC[C@@H](N)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C11H15N3/c1-2-4-10(12)9-7-14-11-8(9)5-3-6-13-11/h3,5-7,10H,2,4,12H2,1H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | FOPNTDWWWDAVLM-SNVBAGLBSA-N |
| XLogP | 2.36 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |