C11H14N2O3 — CID 171872464
1-(1H-pyrrolo[2,3-b]pyridin-3-yl)butane-1,2,4-triol (PubChem CID 171872464) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-(1H-pyrrolo[2,3-b]pyridin-3-yl)butane-1,2,4-triol.
| Compound Name | 1-(1H-pyrrolo[2,3-b]pyridin-3-yl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872464 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-(1H-pyrrolo[2,3-b]pyridin-3-yl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C11H14N2O3/c14-5-3-9(15)10(16)8-6-13-11-7(8)2-1-4-12-11/h1-2,4,6,9-10,14-16H,3,5H2,(H,12,13) |
| InChIKey | YFKUXSHUMSENTA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |