C9H12N2O5 — CID 171872287
1-(2-nitro-3-pyridinyl)butane-1,2,4-triol (PubChem CID 171872287) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is 1-(2-nitro-3-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(2-nitro-3-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872287 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-(2-nitro-3-pyridinyl)butane-1,2,4-triol |
| SMILES | O=[N+]([O-])c1ncccc1C(O)C(O)CCO |
| InChI | InChI=1S/C9H12N2O5/c12-5-3-7(13)8(14)6-2-1-4-10-9(6)11(15)16/h1-2,4,7-8,12-14H,3,5H2 |
| InChIKey | LCSWZJJCSVOTDI-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|