C8H12N2O3 — CID 171871708
1-pyrimidin-2-ylbutane-1,2,4-triol (PubChem CID 171871708) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-pyrimidin-2-ylbutane-1,2,4-triol.
| Compound Name | 1-pyrimidin-2-ylbutane-1,2,4-triol |
|---|---|
| PubChem CID | 171871708 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1-pyrimidin-2-ylbutane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1ncccn1 |
| InChI | InChI=1S/C8H12N2O3/c11-5-2-6(12)7(13)8-9-3-1-4-10-8/h1,3-4,6-7,11-13H,2,5H2 |
| InChIKey | VTBJUWJEOFSURK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |