C9H12FNO3 — CID 171871784
1-(2-fluoro-4-pyridinyl)butane-1,2,4-triol (PubChem CID 171871784) has the molecular formula C9H12FNO3 and a molecular weight of 201.20 g/mol. Its IUPAC name is 1-(2-fluoro-4-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(2-fluoro-4-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171871784 |
| Molecular Formula | C9H12FNO3 |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1-(2-fluoro-4-pyridinyl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1ccnc(F)c1 |
| InChI | InChI=1S/C9H12FNO3/c10-8-5-6(1-3-11-8)9(14)7(13)2-4-12/h1,3,5,7,9,12-14H,2,4H2 |
| InChIKey | FECHQLORDGUPCM-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|