C12H18O4 — CID 171872248
1-[2-(2-hydroxyethyl)phenyl]butane-1,2,4-triol (PubChem CID 171872248) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethyl)phenyl]butane-1,2,4-triol.
| Compound Name | 1-[2-(2-hydroxyethyl)phenyl]butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872248 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-[2-(2-hydroxyethyl)phenyl]butane-1,2,4-triol |
| SMILES | OCCc1ccccc1C(O)C(O)CCO |
| InChI | InChI=1S/C12H18O4/c13-7-5-9-3-1-2-4-10(9)12(16)11(15)6-8-14/h1-4,11-16H,5-8H2 |
| InChIKey | WMFUEDHVVKVTRT-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |