C15H23NO4 — CID 171883384
N-[3,4-dihydroxy-4-[2-(3-hydroxypropyl)phenyl]butyl]acetamide (PubChem CID 171883384) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is N-[3,4-dihydroxy-4-[2-(3-hydroxypropyl)phenyl]butyl]acetamide.
| Compound Name | N-[3,4-dihydroxy-4-[2-(3-hydroxypropyl)phenyl]butyl]acetamide |
|---|---|
| PubChem CID | 171883384 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[3,4-dihydroxy-4-[2-(3-hydroxypropyl)phenyl]butyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccccc1CCCO |
| InChI | InChI=1S/C15H23NO4/c1-11(18)16-9-8-14(19)15(20)13-7-3-2-5-12(13)6-4-10-17/h2-3,5,7,14-15,17,19-20H,4,6,8-10H2,1H3,(H,16,18) |
| InChIKey | MWZPJSMOSHERJW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |