C14H21NO4 — CID 171882991
N-[3,4-dihydroxy-4-[4-(2-hydroxyethyl)phenyl]butyl]acetamide (PubChem CID 171882991) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is N-[3,4-dihydroxy-4-[4-(2-hydroxyethyl)phenyl]butyl]acetamide.
| Compound Name | N-[3,4-dihydroxy-4-[4-(2-hydroxyethyl)phenyl]butyl]acetamide |
|---|---|
| PubChem CID | 171882991 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-[3,4-dihydroxy-4-[4-(2-hydroxyethyl)phenyl]butyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc(CCO)cc1 |
| InChI | InChI=1S/C14H21NO4/c1-10(17)15-8-6-13(18)14(19)12-4-2-11(3-5-12)7-9-16/h2-5,13-14,16,18-19H,6-9H2,1H3,(H,15,17) |
| InChIKey | DRPSSKLIRGAEQT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |