C12H16FNO5S — CID 171883365
4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride (PubChem CID 171883365) has the molecular formula C12H16FNO5S and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride.
| Compound Name | 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 171883365 |
| Molecular Formula | C12H16FNO5S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C12H16FNO5S/c1-8(15)14-7-6-11(16)12(17)9-2-4-10(5-3-9)20(13,18)19/h2-5,11-12,16-17H,6-7H2,1H3,(H,14,15) |
| InChIKey | CHBHSWGAXZLXLE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |