4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride

C12H16FNO5S — CID 171883365

IUPAC4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride
SMILESCC(=O)NCCC(O)C(O)c1ccc(S(=O)(=O)F)cc1
InChIInChI=1S/C12H16FNO5S/c1-8(15)14-7-6-11(16)12(17)9-2-4-10(5-3-9)20(13,18)19/h2-5,11-12,16-17H,6-7H2,1H3,(H,14,15)
InChIKeyCHBHSWGAXZLXLE-UHFFFAOYSA-N
MW305.33 g/mol
LogP0.27
Rot. Bonds6

About 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride

4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride (PubChem CID 171883365) has the molecular formula C12H16FNO5S and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride.

Molecular Properties

Compound Name4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride
PubChem CID171883365
Molecular FormulaC12H16FNO5S
Molecular Weight305.33 g/mol
Exact Mass305.07
IUPAC Name4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride
SMILESCC(=O)NCCC(O)C(O)c1ccc(S(=O)(=O)F)cc1
InChIInChI=1S/C12H16FNO5S/c1-8(15)14-7-6-11(16)12(17)9-2-4-10(5-3-9)20(13,18)19/h2-5,11-12,16-17H,6-7H2,1H3,(H,14,15)
InChIKeyCHBHSWGAXZLXLE-UHFFFAOYSA-N
XLogP0.27
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.33
LogP ≤ 50.27
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride?
The IUPAC name of 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride (CID 171883365) is 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride.
What is the SMILES notation for 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride?
The canonical SMILES for 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride is CC(=O)NCCC(O)C(O)c1ccc(S(=O)(=O)F)cc1.
What is the InChIKey of 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride?
The InChIKey is CHBHSWGAXZLXLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO5S/c1-8(15)14-7-6-11(16)12(17)9-2-4-10(5-3-9)20(13,18)19/h2-5,11-12,16-17H,6-7H2,1H3,(H,14,15).
What are the key properties of 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride?
4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride has a molecular weight of 305.33 g/mol, XLogP of 0.27, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-acetamido-1,2-dihydroxybutyl)benzenesulfonyl fluoride is sourced from PubChem (CID 171883365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).