C9H10BrFO4S — CID 171860298
4-(3-bromo-1,2-dihydroxypropyl)benzenesulfonyl fluoride (PubChem CID 171860298) has the molecular formula C9H10BrFO4S and a molecular weight of 313.14 g/mol. Its IUPAC name is 4-(3-bromo-1,2-dihydroxypropyl)benzenesulfonyl fluoride.
| Compound Name | 4-(3-bromo-1,2-dihydroxypropyl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 171860298 |
| Molecular Formula | C9H10BrFO4S |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 4-(3-bromo-1,2-dihydroxypropyl)benzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccc(C(O)C(O)CBr)cc1 |
| InChI | InChI=1S/C9H10BrFO4S/c10-5-8(12)9(13)6-1-3-7(4-2-6)16(11,14)15/h1-4,8-9,12-13H,5H2 |
| InChIKey | QQTYWRDITIYLGJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|