C9H11BrFNO4S — CID 171860667
4-(3-bromo-1,2-dihydroxypropyl)-3-fluorobenzenesulfonamide (PubChem CID 171860667) has the molecular formula C9H11BrFNO4S and a molecular weight of 328.16 g/mol. Its IUPAC name is 4-(3-bromo-1,2-dihydroxypropyl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-(3-bromo-1,2-dihydroxypropyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 171860667 |
| Molecular Formula | C9H11BrFNO4S |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 4-(3-bromo-1,2-dihydroxypropyl)-3-fluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(O)C(O)CBr)c(F)c1 |
| InChI | InChI=1S/C9H11BrFNO4S/c10-4-8(13)9(14)6-2-1-5(3-7(6)11)17(12,15)16/h1-3,8-9,13-14H,4H2,(H2,12,15,16) |
| InChIKey | BPYYJVGAFMGJPQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|