C10H14FNO3S — CID 84803337
3-amino-1-(2-fluoro-4-methylsulfonylphenyl)propan-1-ol (PubChem CID 84803337) has the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-amino-1-(2-fluoro-4-methylsulfonylphenyl)propan-1-ol.
| Compound Name | 3-amino-1-(2-fluoro-4-methylsulfonylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 84803337 |
| Molecular Formula | C10H14FNO3S |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 3-amino-1-(2-fluoro-4-methylsulfonylphenyl)propan-1-ol |
| SMILES | CS(=O)(=O)c1ccc(C(O)CCN)c(F)c1 |
| InChI | InChI=1S/C10H14FNO3S/c1-16(14,15)7-2-3-8(9(11)6-7)10(13)4-5-12/h2-3,6,10,13H,4-5,12H2,1H3 |
| InChIKey | AAYNDCPNHAXTKC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |