C10H14FNO2S — CID 84794355
3-(2-fluoro-4-methylsulfonylphenyl)propan-1-amine (PubChem CID 84794355) has the molecular formula C10H14FNO2S and a molecular weight of 231.29 g/mol. Its IUPAC name is 3-(2-fluoro-4-methylsulfonylphenyl)propan-1-amine.
| Compound Name | 3-(2-fluoro-4-methylsulfonylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 84794355 |
| Molecular Formula | C10H14FNO2S |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-(2-fluoro-4-methylsulfonylphenyl)propan-1-amine |
| SMILES | CS(=O)(=O)c1ccc(CCCN)c(F)c1 |
| InChI | InChI=1S/C10H14FNO2S/c1-15(13,14)9-5-4-8(3-2-6-12)10(11)7-9/h4-5,7H,2-3,6,12H2,1H3 |
| InChIKey | MQSRNARNJIVVCM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |