C8H11FN2O2S — CID 125498168
4-(aminomethyl)-3-fluoro-N-methylbenzenesulfonamide (PubChem CID 125498168) has the molecular formula C8H11FN2O2S and a molecular weight of 218.25 g/mol. Its IUPAC name is 4-(aminomethyl)-3-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 4-(aminomethyl)-3-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 125498168 |
| Molecular Formula | C8H11FN2O2S |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 4-(aminomethyl)-3-fluoro-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(CN)c(F)c1 |
| InChI | InChI=1S/C8H11FN2O2S/c1-11-14(12,13)7-3-2-6(5-10)8(9)4-7/h2-4,11H,5,10H2,1H3 |
| InChIKey | LOAIRGOFLBODNE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |