C9H13FN2O2S — CID 63287982
3-(aminomethyl)-N-ethyl-4-fluorobenzenesulfonamide (PubChem CID 63287982) has the molecular formula C9H13FN2O2S and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-(aminomethyl)-N-ethyl-4-fluorobenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-N-ethyl-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 63287982 |
| Molecular Formula | C9H13FN2O2S |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-(aminomethyl)-N-ethyl-4-fluorobenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(F)c(CN)c1 |
| InChI | InChI=1S/C9H13FN2O2S/c1-2-12-15(13,14)8-3-4-9(10)7(5-8)6-11/h3-5,12H,2,6,11H2,1H3 |
| InChIKey | HDHMSHKNIMQIQK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |